Trimethylamine – The smell of fish

Trimethylamine is a fascinating compound that plays a crucial role in the distinctive smell of fish. Let me weave a story around this intriguing molecule.

Once upon a time in a quaint fishing village nestled by the sea, there lived a curious young chemist named Marina. Marina had always been captivated by the mysteries of the ocean and its inhabitants. One day, as she strolled along the docks, she couldn’t help but notice the pungent aroma of fish that filled the air.

Intrigued by the smell, Marina decided to investigate its source. She embarked on a journey to unravel the chemistry behind the unmistakable scent of fish. Her quest led her to the discovery of trimethylamine, a compound that occurs naturally in many marine organisms.

Marina delved into her research, studying the chemical reactions that produced trimethylamine in fish. She learned that when certain proteins in fish started to break down, either through bacterial action or enzymatic processes, they released trimethylamine as a byproduct. This compound was responsible for the fishy odor that wafted through the air.

Determined to share her findings with the world, Marina organized a science fair in her village. She set up colorful displays, diagrams, and interactive experiments to explain the connection between trimethylamine and the smell of fish. Villagers, young and old, gathered around to learn about the chemistry of the sea.

As Marina spoke passionately about her discoveries, she ignited a spark of curiosity in the hearts of the villagers. They began to appreciate the intricate processes that occurred within the fish they caught and consumed daily. The once-overpowering scent of fish transformed into a reminder of the rich chemical tapestry of the ocean.

Marina’s story spread beyond the village, reaching scientists and enthusiasts worldwide. Her research became a cornerstone in understanding the aromas of marine life. Trimethylamine, once merely a component of a fishy odor, became a symbol of the intricate relationship between chemistry and the natural world.

And so, in this small fishing village, Marina’s fascination with trimethylamine not only unveiled the secret behind the smell of fish but also sparked a newfound appreciation for the wonders of chemistry that surrounded them.

Formula: C₃H₉N

Molecular weight: 59.11

IUPAC Standard InChI: InChI=1S/C3H9N/c1-4(2)3/h1-3H3

IUPAC Standard InChIKey: GETQZCLCWQTVFV-UHFFFAOYSA-N

CAS Registry Number: 75-50-3

Odor description: fishy, seafood

Odor threshold (in water): 440 μg/L